N-(3,4-dihydro-2H-1-benzopyran-3-yl)-N'-[(4-methylphenyl)methyl]urea
Chemical Structure Depiction of
N-(3,4-dihydro-2H-1-benzopyran-3-yl)-N'-[(4-methylphenyl)methyl]urea
N-(3,4-dihydro-2H-1-benzopyran-3-yl)-N'-[(4-methylphenyl)methyl]urea
Compound characteristics
| Compound ID: | G765-0068 |
| Compound Name: | N-(3,4-dihydro-2H-1-benzopyran-3-yl)-N'-[(4-methylphenyl)methyl]urea |
| Molecular Weight: | 296.37 |
| Molecular Formula: | C18 H20 N2 O2 |
| Smiles: | Cc1ccc(CNC(NC2Cc3ccccc3OC2)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3564 |
| logD: | 3.3564 |
| logSw: | -3.4059 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.089 |
| InChI Key: | MDKIPHWIQNITGX-INIZCTEOSA-N |