methyl 2-[2-({3-[(2-methoxyphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamido]benzoate
Chemical Structure Depiction of
methyl 2-[2-({3-[(2-methoxyphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamido]benzoate
methyl 2-[2-({3-[(2-methoxyphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamido]benzoate
Compound characteristics
| Compound ID: | G766-1272 |
| Compound Name: | methyl 2-[2-({3-[(2-methoxyphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamido]benzoate |
| Molecular Weight: | 473.55 |
| Molecular Formula: | C26 H23 N3 O4 S |
| Smiles: | COC(c1ccccc1NC(CSc1c(Cc2ccccc2OC)nc2ccccc2n1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2269 |
| logD: | 5.2104 |
| logSw: | -5.0693 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.281 |
| InChI Key: | VAUPHMCSKCESFG-UHFFFAOYSA-N |