N-(3-chlorophenyl)-2-({3-[(4-methylphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-({3-[(4-methylphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamide
N-(3-chlorophenyl)-2-({3-[(4-methylphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | G766-1491 |
| Compound Name: | N-(3-chlorophenyl)-2-({3-[(4-methylphenyl)methyl]quinoxalin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 433.96 |
| Molecular Formula: | C24 H20 Cl N3 O S |
| Smiles: | Cc1ccc(Cc2c(nc3ccccc3n2)SCC(Nc2cccc(c2)[Cl])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.415 |
| logD: | 6.4148 |
| logSw: | -6.1462 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.175 |
| InChI Key: | OLECJJPXCLYUHR-UHFFFAOYSA-N |