7-({benzyl[(4-fluorophenyl)methyl]amino}methyl)-2-cyclohexyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
Chemical Structure Depiction of
7-({benzyl[(4-fluorophenyl)methyl]amino}methyl)-2-cyclohexyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
7-({benzyl[(4-fluorophenyl)methyl]amino}methyl)-2-cyclohexyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
Compound characteristics
| Compound ID: | G768-2152 |
| Compound Name: | 7-({benzyl[(4-fluorophenyl)methyl]amino}methyl)-2-cyclohexyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| Molecular Weight: | 462.59 |
| Molecular Formula: | C26 H27 F N4 O S |
| Smiles: | C1CCC(CC1)C1=NN2C(=NC(CN(Cc3ccccc3)Cc3ccc(cc3)F)=CC2=O)S1 |
| Stereo: | ACHIRAL |
| logP: | 5.4098 |
| logD: | 5.3976 |
| logSw: | -5.4783 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.903 |
| InChI Key: | DBFIOQOYKCNCDK-UHFFFAOYSA-N |