7-({[(4-chlorophenyl)methyl](methyl)amino}methyl)-2-phenyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
Chemical Structure Depiction of
7-({[(4-chlorophenyl)methyl](methyl)amino}methyl)-2-phenyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
7-({[(4-chlorophenyl)methyl](methyl)amino}methyl)-2-phenyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one
Compound characteristics
| Compound ID: | G768-2192 |
| Compound Name: | 7-({[(4-chlorophenyl)methyl](methyl)amino}methyl)-2-phenyl-5H-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| Molecular Weight: | 396.9 |
| Molecular Formula: | C20 H17 Cl N4 O S |
| Smiles: | CN(CC1=CC(N2C(=N1)SC(c1ccccc1)=N2)=O)Cc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.7265 |
| logD: | 3.6498 |
| logSw: | -4.3477 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.115 |
| InChI Key: | LONHYZSJGGXQCY-UHFFFAOYSA-N |