5-(3-methoxyphenyl)-N-[(4-methylphenyl)methyl]-6H-imidazo[1,2-b][1,2,4]triazol-6-imine
Chemical Structure Depiction of
5-(3-methoxyphenyl)-N-[(4-methylphenyl)methyl]-6H-imidazo[1,2-b][1,2,4]triazol-6-imine
5-(3-methoxyphenyl)-N-[(4-methylphenyl)methyl]-6H-imidazo[1,2-b][1,2,4]triazol-6-imine
Compound characteristics
| Compound ID: | G773-0115 |
| Compound Name: | 5-(3-methoxyphenyl)-N-[(4-methylphenyl)methyl]-6H-imidazo[1,2-b][1,2,4]triazol-6-imine |
| Molecular Weight: | 331.38 |
| Molecular Formula: | C19 H17 N5 O |
| Smiles: | Cc1ccc(C/N=C2\C(c3cccc(c3)OC)=Nc3ncnn23)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.7696 |
| logD: | 3.7583 |
| logSw: | -3.9548 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 51.102 |
| InChI Key: | UVYUALLZXFFBPL-UHFFFAOYSA-N |