N~2~-methyl-N~4~-(4-methylphenyl)-5-nitropyrimidine-2,4,6-triamine
Chemical Structure Depiction of
N~2~-methyl-N~4~-(4-methylphenyl)-5-nitropyrimidine-2,4,6-triamine
N~2~-methyl-N~4~-(4-methylphenyl)-5-nitropyrimidine-2,4,6-triamine
Compound characteristics
| Compound ID: | G786-0014 |
| Compound Name: | N~2~-methyl-N~4~-(4-methylphenyl)-5-nitropyrimidine-2,4,6-triamine |
| Molecular Weight: | 274.28 |
| Molecular Formula: | C12 H14 N6 O2 |
| Smiles: | Cc1ccc(cc1)Nc1c(c(N)nc(NC)n1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.5735 |
| logD: | 2.5728 |
| logSw: | -2.9659 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 93.629 |
| InChI Key: | WNXXUKDKYQKKML-UHFFFAOYSA-N |