N~2~-(3-methylbutyl)-5-nitro-N~4~-phenylpyrimidine-2,4,6-triamine
Chemical Structure Depiction of
N~2~-(3-methylbutyl)-5-nitro-N~4~-phenylpyrimidine-2,4,6-triamine
N~2~-(3-methylbutyl)-5-nitro-N~4~-phenylpyrimidine-2,4,6-triamine
Compound characteristics
| Compound ID: | G786-0190 |
| Compound Name: | N~2~-(3-methylbutyl)-5-nitro-N~4~-phenylpyrimidine-2,4,6-triamine |
| Molecular Weight: | 316.36 |
| Molecular Formula: | C15 H20 N6 O2 |
| Smiles: | CC(C)CCNc1nc(c(c(Nc2ccccc2)n1)[N+]([O-])=O)N |
| Stereo: | ACHIRAL |
| logP: | 3.6579 |
| logD: | 3.6577 |
| logSw: | -4.0657 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 93.32 |
| InChI Key: | JKVGWZAIRBQROR-UHFFFAOYSA-N |