N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole-6-carboxamide
Chemical Structure Depiction of
N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole-6-carboxamide
N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole-6-carboxamide
Compound characteristics
| Compound ID: | G786-0297 |
| Compound Name: | N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole-6-carboxamide |
| Molecular Weight: | 387.48 |
| Molecular Formula: | C21 H13 N3 O S2 |
| Smiles: | c1ccc2c(c1)nc(c1ccc(cc1)NC(c1ccc3c(c1)scn3)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 5.2147 |
| logD: | 5.2147 |
| logSw: | -5.534 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.122 |
| InChI Key: | WPVLNNAIOXEHRC-UHFFFAOYSA-N |