4-(diethylsulfamoyl)-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide
Chemical Structure Depiction of
4-(diethylsulfamoyl)-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide
4-(diethylsulfamoyl)-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide
Compound characteristics
| Compound ID: | G786-0866 |
| Compound Name: | 4-(diethylsulfamoyl)-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide |
| Molecular Weight: | 417.55 |
| Molecular Formula: | C20 H23 N3 O3 S2 |
| Smiles: | CCN(CC)S(c1ccc(cc1)C(Nc1nc2cc(C)cc(C)c2s1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.835 |
| logD: | 4.8266 |
| logSw: | -4.567 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.187 |
| InChI Key: | NQQAGUAOSKFWPG-UHFFFAOYSA-N |