N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide
Chemical Structure Depiction of
N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide
N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide
Compound characteristics
| Compound ID: | G786-1131 |
| Compound Name: | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| Molecular Weight: | 452.34 |
| Molecular Formula: | C18 H11 Cl2 N3 O3 S2 |
| Smiles: | C1CC(N(C1=O)c1cccc(c1)C(Nc1nc(cs1)c1cc(sc1[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4186 |
| logD: | 3.41 |
| logSw: | -4.1163 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.591 |
| InChI Key: | MAJKATGESVDPOD-UHFFFAOYSA-N |