N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(4-methylbenzene-1-sulfonyl)acetamide
Chemical Structure Depiction of
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(4-methylbenzene-1-sulfonyl)acetamide
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(4-methylbenzene-1-sulfonyl)acetamide
Compound characteristics
| Compound ID: | G786-1298 |
| Compound Name: | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2-(4-methylbenzene-1-sulfonyl)acetamide |
| Molecular Weight: | 412.93 |
| Molecular Formula: | C16 H13 Cl N2 O3 S3 |
| Smiles: | Cc1ccc(cc1)S(CC(Nc1nc(cs1)c1ccc(s1)[Cl])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4774 |
| logD: | 4.4773 |
| logSw: | -4.442 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.946 |
| InChI Key: | BLOHFJUGSOXEDX-UHFFFAOYSA-N |