N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-fluorobenzene-1-sulfonyl)acetamide
Chemical Structure Depiction of
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-fluorobenzene-1-sulfonyl)acetamide
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-fluorobenzene-1-sulfonyl)acetamide
Compound characteristics
| Compound ID: | G786-1348 |
| Compound Name: | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-fluorobenzene-1-sulfonyl)acetamide |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C15 H17 F N2 O3 S2 |
| Smiles: | CC(C)(C)c1csc(NC(CS(c2ccc(cc2)F)(=O)=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.2888 |
| logD: | 3.2745 |
| logSw: | -3.6289 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.199 |
| InChI Key: | PKGMBXXJOGFTNY-UHFFFAOYSA-N |