N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(methanesulfonyl)benzamide
Chemical Structure Depiction of
N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(methanesulfonyl)benzamide
N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(methanesulfonyl)benzamide
Compound characteristics
| Compound ID: | G786-1406 |
| Compound Name: | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(methanesulfonyl)benzamide |
| Molecular Weight: | 443.36 |
| Molecular Formula: | C15 H11 Br N2 O3 S3 |
| Smiles: | CS(c1ccccc1C(Nc1nc(cs1)c1ccc(s1)[Br])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.813 |
| logD: | 3.8037 |
| logSw: | -4.0505 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.872 |
| InChI Key: | BKZPHMVRPMYPJQ-UHFFFAOYSA-N |