N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-2-(ethanesulfonyl)benzamide
Chemical Structure Depiction of
N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-2-(ethanesulfonyl)benzamide
N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-2-(ethanesulfonyl)benzamide
Compound characteristics
| Compound ID: | G786-1457 |
| Compound Name: | N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-2-(ethanesulfonyl)benzamide |
| Molecular Weight: | 429.54 |
| Molecular Formula: | C19 H15 N3 O3 S3 |
| Smiles: | CCS(c1ccccc1C(Nc1nc(cs1)c1nc2ccccc2s1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2879 |
| logD: | 4.259 |
| logSw: | -4.3067 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.861 |
| InChI Key: | NCOXTKVVJWQJBO-UHFFFAOYSA-N |