2-[(2-cyclopropyl-6,8-dimethyl-5,7-dioxo-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide
Chemical Structure Depiction of
2-[(2-cyclopropyl-6,8-dimethyl-5,7-dioxo-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide
2-[(2-cyclopropyl-6,8-dimethyl-5,7-dioxo-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | G786-1734 |
| Compound Name: | 2-[(2-cyclopropyl-6,8-dimethyl-5,7-dioxo-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide |
| Molecular Weight: | 441.51 |
| Molecular Formula: | C21 H23 N5 O4 S |
| Smiles: | CCOc1ccc(cc1)NC(CSc1c2C(N(C)C(N(C)c2nc(C2CC2)n1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6005 |
| logD: | 3.6005 |
| logSw: | -3.8948 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.58 |
| InChI Key: | RANASAZAHPNLQV-UHFFFAOYSA-N |