N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-3-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-3-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-3-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | G789-1508 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-1-(4-fluorophenyl)-3-methyl-1H-thieno[2,3-c]pyrazole-5-carboxamide |
| Molecular Weight: | 411.45 |
| Molecular Formula: | C21 H18 F N3 O3 S |
| Smiles: | Cc1c2cc(C(Nc3ccc(cc3OC)OC)=O)sc2n(c2ccc(cc2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.4387 |
| logD: | 4.4385 |
| logSw: | -4.3794 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.581 |
| InChI Key: | DDBUDSGEEORRIK-UHFFFAOYSA-N |