methyl 3-(3-chlorophenyl)-5-(3-fluoroanilino)-1,2-oxazole-4-carboxylate
Chemical Structure Depiction of
methyl 3-(3-chlorophenyl)-5-(3-fluoroanilino)-1,2-oxazole-4-carboxylate
methyl 3-(3-chlorophenyl)-5-(3-fluoroanilino)-1,2-oxazole-4-carboxylate
Compound characteristics
| Compound ID: | G790-1219 |
| Compound Name: | methyl 3-(3-chlorophenyl)-5-(3-fluoroanilino)-1,2-oxazole-4-carboxylate |
| Molecular Weight: | 346.74 |
| Molecular Formula: | C17 H12 Cl F N2 O3 |
| Smiles: | COC(c1c(c2cccc(c2)[Cl])noc1Nc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6005 |
| logD: | 4.6005 |
| logSw: | -4.9823 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.911 |
| InChI Key: | NKTHQHIYQHEISP-UHFFFAOYSA-N |