methyl 5-{[(4-methylphenyl)methyl]amino}-3-phenyl-1,2-oxazole-4-carboxylate
Chemical Structure Depiction of
methyl 5-{[(4-methylphenyl)methyl]amino}-3-phenyl-1,2-oxazole-4-carboxylate
methyl 5-{[(4-methylphenyl)methyl]amino}-3-phenyl-1,2-oxazole-4-carboxylate
Compound characteristics
| Compound ID: | G790-1884 |
| Compound Name: | methyl 5-{[(4-methylphenyl)methyl]amino}-3-phenyl-1,2-oxazole-4-carboxylate |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C19 H18 N2 O3 |
| Smiles: | Cc1ccc(CNc2c(C(=O)OC)c(c3ccccc3)no2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.516 |
| logD: | 3.516 |
| logSw: | -3.6347 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.233 |
| InChI Key: | PHHGZXDOVCRZBW-UHFFFAOYSA-N |