N-(3-chloro-4-methylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide
N-(3-chloro-4-methylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | G792-0596 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide |
| Molecular Weight: | 424.85 |
| Molecular Formula: | C21 H20 Cl F3 N2 O2 |
| Smiles: | Cc1ccc(cc1[Cl])NC(C1CCCN(C1)C(c1cccc(c1)C(F)(F)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6171 |
| logD: | 4.616 |
| logSw: | -4.7571 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.911 |
| InChI Key: | BWRBPNKLVYATHN-HNNXBMFYSA-N |