1-(3,5-dimethylbenzoyl)-N-[3-(methylsulfanyl)phenyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-(3,5-dimethylbenzoyl)-N-[3-(methylsulfanyl)phenyl]piperidine-3-carboxamide
1-(3,5-dimethylbenzoyl)-N-[3-(methylsulfanyl)phenyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | G792-2353 |
| Compound Name: | 1-(3,5-dimethylbenzoyl)-N-[3-(methylsulfanyl)phenyl]piperidine-3-carboxamide |
| Molecular Weight: | 382.52 |
| Molecular Formula: | C22 H26 N2 O2 S |
| Smiles: | Cc1cc(C)cc(c1)C(N1CCCC(C1)C(Nc1cccc(c1)SC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7528 |
| logD: | 3.7528 |
| logSw: | -3.8257 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.911 |
| InChI Key: | XUNWJFGDADTPGA-KRWDZBQOSA-N |