N-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
N-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G794-1132 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 361.23 |
| Molecular Formula: | C18 H14 Cl2 N2 O2 |
| Smiles: | Cc1ccc(cc1[Cl])NC(c1c(c2cccc(c2)[Cl])noc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5503 |
| logD: | 5.5492 |
| logSw: | -6.1635 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.29 |
| InChI Key: | CYCWLXCAQLOFQD-UHFFFAOYSA-N |