3-(3-bromophenyl)-5-methyl-N-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(3-bromophenyl)-5-methyl-N-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxamide
3-(3-bromophenyl)-5-methyl-N-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G794-1831 |
| Compound Name: | 3-(3-bromophenyl)-5-methyl-N-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 399.29 |
| Molecular Formula: | C20 H19 Br N2 O2 |
| Smiles: | Cc1cc(C)c(c(C)c1)NC(c1c(c2cccc(c2)[Br])noc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.722 |
| logD: | 4.722 |
| logSw: | -4.6335 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.894 |
| InChI Key: | CNMURCKCHBCRNK-UHFFFAOYSA-N |