3-(3-fluorophenyl)-5-methyl-N-[(5-methylfuran-2-yl)methyl]-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(3-fluorophenyl)-5-methyl-N-[(5-methylfuran-2-yl)methyl]-1,2-oxazole-4-carboxamide
3-(3-fluorophenyl)-5-methyl-N-[(5-methylfuran-2-yl)methyl]-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G794-2198 |
| Compound Name: | 3-(3-fluorophenyl)-5-methyl-N-[(5-methylfuran-2-yl)methyl]-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 314.31 |
| Molecular Formula: | C17 H15 F N2 O3 |
| Smiles: | [H]N(Cc1ccc(C)o1)C(c1c(c2cccc(c2)F)noc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2166 |
| logD: | 3.2166 |
| logSw: | -3.5025 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.875 |
| InChI Key: | IFCAPEDUUQEMEA-UHFFFAOYSA-N |