3-(4-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(4-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1,2-oxazole-4-carboxamide
3-(4-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G794-2446 |
| Compound Name: | 3-(4-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 445.31 |
| Molecular Formula: | C21 H21 Br N2 O4 |
| Smiles: | Cc1c(C(NCCc2ccc(c(c2)OC)OC)=O)c(c2ccc(cc2)[Br])no1 |
| Stereo: | ACHIRAL |
| logP: | 3.2344 |
| logD: | 3.2344 |
| logSw: | -3.5379 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.714 |
| InChI Key: | NHLSJOAZFCKQRM-UHFFFAOYSA-N |