N-[4-(benzylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide
Chemical Structure Depiction of
N-[4-(benzylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide
N-[4-(benzylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide
Compound characteristics
| Compound ID: | G795-0003 |
| Compound Name: | N-[4-(benzylcarbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide |
| Molecular Weight: | 387.46 |
| Molecular Formula: | C22 H17 N3 O2 S |
| Smiles: | C(c1ccccc1)NC(c1ccc(cc1)NC(c1c2ccccc2sn1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2196 |
| logD: | 4.2196 |
| logSw: | -4.4274 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.733 |
| InChI Key: | PAOIAYVUULGSCO-UHFFFAOYSA-N |