N-[2-({[4-(methylsulfanyl)phenyl]methyl}carbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide
Chemical Structure Depiction of
N-[2-({[4-(methylsulfanyl)phenyl]methyl}carbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide
N-[2-({[4-(methylsulfanyl)phenyl]methyl}carbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide
Compound characteristics
| Compound ID: | G795-0599 |
| Compound Name: | N-[2-({[4-(methylsulfanyl)phenyl]methyl}carbamoyl)phenyl]-1,2-benzothiazole-3-carboxamide |
| Molecular Weight: | 433.55 |
| Molecular Formula: | C23 H19 N3 O2 S2 |
| Smiles: | CSc1ccc(CNC(c2ccccc2NC(c2c3ccccc3sn2)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.165 |
| logD: | 5.1649 |
| logSw: | -5.1423 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.035 |
| InChI Key: | DOFJOQBCJRTGSR-UHFFFAOYSA-N |