1-(1H-benzimidazol-2-yl)-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide
Chemical Structure Depiction of
1-(1H-benzimidazol-2-yl)-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide
1-(1H-benzimidazol-2-yl)-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G796-0610 |
| Compound Name: | 1-(1H-benzimidazol-2-yl)-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide |
| Molecular Weight: | 380.51 |
| Molecular Formula: | C21 H24 N4 O S |
| Smiles: | CSc1ccc(CNC(C2CCN(CC2)c2nc3ccccc3[nH]2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3355 |
| logD: | 3.3037 |
| logSw: | -3.4265 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 46.322 |
| InChI Key: | TZTPTILRQGIYKC-UHFFFAOYSA-N |