1-(6-bromo-1H-benzimidazol-2-yl)-N-cyclohexylpiperidine-3-carboxamide
Chemical Structure Depiction of
1-(6-bromo-1H-benzimidazol-2-yl)-N-cyclohexylpiperidine-3-carboxamide
1-(6-bromo-1H-benzimidazol-2-yl)-N-cyclohexylpiperidine-3-carboxamide
Compound characteristics
| Compound ID: | G796-1464 |
| Compound Name: | 1-(6-bromo-1H-benzimidazol-2-yl)-N-cyclohexylpiperidine-3-carboxamide |
| Molecular Weight: | 405.34 |
| Molecular Formula: | C19 H25 Br N4 O |
| Smiles: | C1CCC(CC1)NC(C1CCCN(C1)c1nc2ccc(cc2[nH]1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9685 |
| logD: | 3.9203 |
| logSw: | -4.0241 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.981 |
| InChI Key: | SGCGBKCUDLOKSK-ZDUSSCGKSA-N |