1-(1H-benzimidazol-2-yl)-N-(2-ethylphenyl)piperidine-3-carboxamide
Chemical Structure Depiction of
1-(1H-benzimidazol-2-yl)-N-(2-ethylphenyl)piperidine-3-carboxamide
1-(1H-benzimidazol-2-yl)-N-(2-ethylphenyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | G796-1977 |
| Compound Name: | 1-(1H-benzimidazol-2-yl)-N-(2-ethylphenyl)piperidine-3-carboxamide |
| Molecular Weight: | 348.45 |
| Molecular Formula: | C21 H24 N4 O |
| Smiles: | CCc1ccccc1NC(C1CCCN(C1)c1nc2ccccc2[nH]1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7191 |
| logD: | 3.6709 |
| logSw: | -3.8831 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.236 |
| InChI Key: | PCPLFAKYMHDISM-INIZCTEOSA-N |