1-(1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide
					Chemical Structure Depiction of
1-(1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide
			1-(1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | G796-2027 | 
| Compound Name: | 1-(1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide | 
| Molecular Weight: | 364.45 | 
| Molecular Formula: | C21 H24 N4 O2 | 
| Smiles: | COc1ccccc1CNC(C1CCCN(C1)c1nc2ccccc2[nH]1)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.8311 | 
| logD: | 2.7829 | 
| logSw: | -3.137 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 53.886 | 
| InChI Key: | KYIGLKBCWBVFND-INIZCTEOSA-N | 
 
				 
				