1-(1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-(1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-3-carboxamide
1-(1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | G796-2213 |
| Compound Name: | 1-(1H-benzimidazol-2-yl)-N-[(4-ethylphenyl)methyl]piperidine-3-carboxamide |
| Molecular Weight: | 362.47 |
| Molecular Formula: | C22 H26 N4 O |
| Smiles: | CCc1ccc(CNC(C2CCCN(C2)c2nc3ccccc3[nH]2)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5404 |
| logD: | 3.4923 |
| logSw: | -3.4948 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 46.256 |
| InChI Key: | QDFNFGSULAOBTK-SFHVURJKSA-N |