ethyl 4-({N-[(4-methoxyphenyl)methyl]butanamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-({N-[(4-methoxyphenyl)methyl]butanamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
ethyl 4-({N-[(4-methoxyphenyl)methyl]butanamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G798-0162 |
| Compound Name: | ethyl 4-({N-[(4-methoxyphenyl)methyl]butanamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 386.49 |
| Molecular Formula: | C22 H30 N2 O4 |
| Smiles: | CCCC(N(Cc1ccc(cc1)OC)Cc1c(C)c(C(=O)OCC)[nH]c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9594 |
| logD: | 3.9594 |
| logSw: | -3.9781 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.201 |
| InChI Key: | JGQZNHPAJFQBJD-UHFFFAOYSA-N |