ethyl 4-({3,5-dimethoxy-N-[(oxolan-2-yl)methyl]benzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-({3,5-dimethoxy-N-[(oxolan-2-yl)methyl]benzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
ethyl 4-({3,5-dimethoxy-N-[(oxolan-2-yl)methyl]benzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G798-0543 |
| Compound Name: | ethyl 4-({3,5-dimethoxy-N-[(oxolan-2-yl)methyl]benzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 444.53 |
| Molecular Formula: | C24 H32 N2 O6 |
| Smiles: | CCOC(c1c(C)c(CN(CC2CCCO2)C(c2cc(cc(c2)OC)OC)=O)c(C)[nH]1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1535 |
| logD: | 3.1535 |
| logSw: | -3.2038 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.655 |
| InChI Key: | FWUDODALPGRBOL-GOSISDBHSA-N |