ethyl 3,5-dimethyl-4-({[(oxolan-2-yl)methyl](thiophene-2-carbonyl)amino}methyl)-1H-pyrrole-2-carboxylate
					Chemical Structure Depiction of
ethyl 3,5-dimethyl-4-({[(oxolan-2-yl)methyl](thiophene-2-carbonyl)amino}methyl)-1H-pyrrole-2-carboxylate
			ethyl 3,5-dimethyl-4-({[(oxolan-2-yl)methyl](thiophene-2-carbonyl)amino}methyl)-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G798-0556 | 
| Compound Name: | ethyl 3,5-dimethyl-4-({[(oxolan-2-yl)methyl](thiophene-2-carbonyl)amino}methyl)-1H-pyrrole-2-carboxylate | 
| Molecular Weight: | 390.5 | 
| Molecular Formula: | C20 H26 N2 O4 S | 
| Smiles: | CCOC(c1c(C)c(CN(CC2CCCO2)C(c2cccs2)=O)c(C)[nH]1)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 3.0902 | 
| logD: | 3.0902 | 
| logSw: | -3.1407 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 57.586 | 
| InChI Key: | JCUOEPPEMCPIMU-OAHLLOKOSA-N | 
 
				 
				