ethyl 3,5-dimethyl-4-({3-methyl-N-[(oxolan-2-yl)methyl]benzamido}methyl)-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 3,5-dimethyl-4-({3-methyl-N-[(oxolan-2-yl)methyl]benzamido}methyl)-1H-pyrrole-2-carboxylate
ethyl 3,5-dimethyl-4-({3-methyl-N-[(oxolan-2-yl)methyl]benzamido}methyl)-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G798-0558 |
| Compound Name: | ethyl 3,5-dimethyl-4-({3-methyl-N-[(oxolan-2-yl)methyl]benzamido}methyl)-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 398.5 |
| Molecular Formula: | C23 H30 N2 O4 |
| Smiles: | CCOC(c1c(C)c(CN(CC2CCCO2)C(c2cccc(C)c2)=O)c(C)[nH]1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2408 |
| logD: | 3.2408 |
| logSw: | -3.2852 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.567 |
| InChI Key: | DNMVHUPPXUDFGJ-LJQANCHMSA-N |