ethyl 4-({N-[(4-chlorophenyl)methyl]-3,5-dimethoxybenzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-({N-[(4-chlorophenyl)methyl]-3,5-dimethoxybenzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
ethyl 4-({N-[(4-chlorophenyl)methyl]-3,5-dimethoxybenzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G798-0797 |
| Compound Name: | ethyl 4-({N-[(4-chlorophenyl)methyl]-3,5-dimethoxybenzamido}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 484.98 |
| Molecular Formula: | C26 H29 Cl N2 O5 |
| Smiles: | CCOC(c1c(C)c(CN(Cc2ccc(cc2)[Cl])C(c2cc(cc(c2)OC)OC)=O)c(C)[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0285 |
| logD: | 5.0285 |
| logSw: | -5.2079 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63 |
| InChI Key: | HXRACKSETMRBDP-UHFFFAOYSA-N |