methyl 3,5-dimethyl-4-{[N-methyl-4-(propan-2-yl)benzamido]methyl}-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 3,5-dimethyl-4-{[N-methyl-4-(propan-2-yl)benzamido]methyl}-1H-pyrrole-2-carboxylate
methyl 3,5-dimethyl-4-{[N-methyl-4-(propan-2-yl)benzamido]methyl}-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G798-0961 |
| Compound Name: | methyl 3,5-dimethyl-4-{[N-methyl-4-(propan-2-yl)benzamido]methyl}-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 342.44 |
| Molecular Formula: | C20 H26 N2 O3 |
| Smiles: | [H]n1c(C)c(CN(C)C(c2ccc(cc2)C(C)C)=O)c(C)c1C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.7727 |
| logD: | 3.7727 |
| logSw: | -4.0958 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.544 |
| InChI Key: | RKBCRAXCYANZGT-UHFFFAOYSA-N |