ethyl 4-({(4-methoxybenzene-1-sulfonyl)[(4-methylphenyl)methyl]amino}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-({(4-methoxybenzene-1-sulfonyl)[(4-methylphenyl)methyl]amino}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
ethyl 4-({(4-methoxybenzene-1-sulfonyl)[(4-methylphenyl)methyl]amino}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | G800-0007 |
| Compound Name: | ethyl 4-({(4-methoxybenzene-1-sulfonyl)[(4-methylphenyl)methyl]amino}methyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 470.59 |
| Molecular Formula: | C25 H30 N2 O5 S |
| Smiles: | CCOC(c1c(C)c(CN(Cc2ccc(C)cc2)S(c2ccc(cc2)OC)(=O)=O)c(C)[nH]1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0746 |
| logD: | 5.0746 |
| logSw: | -4.6368 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.621 |
| InChI Key: | LGNIFOSAJGPBNA-UHFFFAOYSA-N |