N-[(2,5-dimethoxyphenyl)methyl]-6-methyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-sulfonamide
Chemical Structure Depiction of
N-[(2,5-dimethoxyphenyl)methyl]-6-methyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-sulfonamide
N-[(2,5-dimethoxyphenyl)methyl]-6-methyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-sulfonamide
Compound characteristics
| Compound ID: | G801-0311 |
| Compound Name: | N-[(2,5-dimethoxyphenyl)methyl]-6-methyl-2-oxo-2,3-dihydro-1H-benzimidazole-5-sulfonamide |
| Molecular Weight: | 377.42 |
| Molecular Formula: | C17 H19 N3 O5 S |
| Smiles: | Cc1cc2c(cc1S(NCc1cc(ccc1OC)OC)(=O)=O)NC(N2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3596 |
| logD: | 2.3581 |
| logSw: | -2.9067 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 92.898 |
| InChI Key: | QWQHZILMNLOJHD-UHFFFAOYSA-N |