3-{[(2-methylphenyl)methyl]sulfanyl}-7-phenyl[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Chemical Structure Depiction of
3-{[(2-methylphenyl)methyl]sulfanyl}-7-phenyl[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
3-{[(2-methylphenyl)methyl]sulfanyl}-7-phenyl[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Compound characteristics
| Compound ID: | G802-0513 |
| Compound Name: | 3-{[(2-methylphenyl)methyl]sulfanyl}-7-phenyl[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one |
| Molecular Weight: | 348.42 |
| Molecular Formula: | C19 H16 N4 O S |
| Smiles: | Cc1ccccc1CSc1nnc2C(N(C=Cn12)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0165 |
| logD: | 3.0165 |
| logSw: | -3.0573 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.702 |
| InChI Key: | PQMFVELVHSTQLZ-UHFFFAOYSA-N |