3-{[(4-fluorophenyl)methyl]sulfanyl}-7-(3-methoxyphenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Chemical Structure Depiction of
3-{[(4-fluorophenyl)methyl]sulfanyl}-7-(3-methoxyphenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
3-{[(4-fluorophenyl)methyl]sulfanyl}-7-(3-methoxyphenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Compound characteristics
| Compound ID: | G802-0717 |
| Compound Name: | 3-{[(4-fluorophenyl)methyl]sulfanyl}-7-(3-methoxyphenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one |
| Molecular Weight: | 382.41 |
| Molecular Formula: | C19 H15 F N4 O2 S |
| Smiles: | COc1cccc(c1)N1C=Cn2c(C1=O)nnc2SCc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 2.2685 |
| logD: | 2.2685 |
| logSw: | -2.6213 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.246 |
| InChI Key: | MNEKNMNJLUFADK-UHFFFAOYSA-N |