3-{[(2-chlorophenyl)methyl]sulfanyl}-7-(3,4-difluorophenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Chemical Structure Depiction of
3-{[(2-chlorophenyl)methyl]sulfanyl}-7-(3,4-difluorophenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
3-{[(2-chlorophenyl)methyl]sulfanyl}-7-(3,4-difluorophenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
Compound characteristics
| Compound ID: | G802-1028 |
| Compound Name: | 3-{[(2-chlorophenyl)methyl]sulfanyl}-7-(3,4-difluorophenyl)[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one |
| Molecular Weight: | 404.82 |
| Molecular Formula: | C18 H11 Cl F2 N4 O S |
| Smiles: | C(c1ccccc1[Cl])Sc1nnc2C(N(C=Cn12)c1ccc(c(c1)F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3798 |
| logD: | 3.3798 |
| logSw: | -3.4768 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.702 |
| InChI Key: | DOWXQQSFXVQCDK-UHFFFAOYSA-N |