N-(3-chloro-4-methoxyphenyl)-3-(3,5-difluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-3-(3,5-difluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
N-(3-chloro-4-methoxyphenyl)-3-(3,5-difluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | G803-0622 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-3-(3,5-difluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 388.76 |
| Molecular Formula: | C18 H11 Cl F2 N4 O2 |
| Smiles: | COc1ccc(cc1[Cl])Nc1c2c(c3cc(cc(c3)F)F)noc2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9204 |
| logD: | 4.9204 |
| logSw: | -5.2694 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.332 |
| InChI Key: | MIZMRZPDCDGBKK-UHFFFAOYSA-N |