3-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
3-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine
3-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | G803-0637 |
| Compound Name: | 3-(3,5-difluorophenyl)-N-[(3-methoxyphenyl)methyl][1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 368.34 |
| Molecular Formula: | C19 H14 F2 N4 O2 |
| Smiles: | COc1cccc(CNc2c3c(c4cc(cc(c4)F)F)noc3ncn2)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.0768 |
| logD: | 4.0768 |
| logSw: | -4.5965 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.567 |
| InChI Key: | USHDCDOWBHOQHK-UHFFFAOYSA-N |