N-cyclopentyl-3-(3-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-cyclopentyl-3-(3-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
N-cyclopentyl-3-(3-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | G803-0757 |
| Compound Name: | N-cyclopentyl-3-(3-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 310.35 |
| Molecular Formula: | C17 H18 N4 O2 |
| Smiles: | COc1cccc(c1)c1c2c(NC3CCCC3)ncnc2on1 |
| Stereo: | ACHIRAL |
| logP: | 3.6763 |
| logD: | 3.6763 |
| logSw: | -4.2143 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.659 |
| InChI Key: | HFWNLBXJVLITPF-UHFFFAOYSA-N |