3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)[1,2]oxazolo[5,4-d]pyrimidine
Chemical Structure Depiction of
3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)[1,2]oxazolo[5,4-d]pyrimidine
3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)[1,2]oxazolo[5,4-d]pyrimidine
Compound characteristics
| Compound ID: | G803-1055 |
| Compound Name: | 3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)[1,2]oxazolo[5,4-d]pyrimidine |
| Molecular Weight: | 309.37 |
| Molecular Formula: | C17 H19 N5 O |
| Smiles: | Cc1ccc(cc1)c1c2c(ncnc2on1)N1CCN(C)CC1 |
| Stereo: | ACHIRAL |
| logP: | 2.8488 |
| logD: | 2.3843 |
| logSw: | -3.1614 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.011 |
| InChI Key: | PPTKLMKNRXSTDC-UHFFFAOYSA-N |