N-(2-{[(furan-2-yl)methyl](3-methoxypropyl)amino}ethyl)-6-methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide
Chemical Structure Depiction of
N-(2-{[(furan-2-yl)methyl](3-methoxypropyl)amino}ethyl)-6-methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide
N-(2-{[(furan-2-yl)methyl](3-methoxypropyl)amino}ethyl)-6-methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide
Compound characteristics
| Compound ID: | G805-0556 |
| Compound Name: | N-(2-{[(furan-2-yl)methyl](3-methoxypropyl)amino}ethyl)-6-methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonamide |
| Molecular Weight: | 437.51 |
| Molecular Formula: | C20 H27 N3 O6 S |
| Smiles: | Cc1cc2c(cc1S(NCCN(CCCOC)Cc1ccco1)(=O)=O)OCC(N2)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6145 |
| logD: | 1.5878 |
| logSw: | -2.5272 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 95.14 |
| InChI Key: | SSPZYSUEWYYIGO-UHFFFAOYSA-N |