N-{[1-(2-methylpropanoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-4-(2-methylpropyl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-{[1-(2-methylpropanoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-4-(2-methylpropyl)benzene-1-sulfonamide
N-{[1-(2-methylpropanoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-4-(2-methylpropyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G810-0741 |
| Compound Name: | N-{[1-(2-methylpropanoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-4-(2-methylpropyl)benzene-1-sulfonamide |
| Molecular Weight: | 414.57 |
| Molecular Formula: | C23 H30 N2 O3 S |
| Smiles: | CC(C)Cc1ccc(cc1)S(NCc1ccc2c(CCN2C(C(C)C)=O)c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0578 |
| logD: | 5.0574 |
| logSw: | -4.6258 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.947 |
| InChI Key: | SZISAUNFZYFHHK-UHFFFAOYSA-N |