(4-chlorophenyl){1-[4-(methylsulfanyl)phenyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl}methanone
Chemical Structure Depiction of
(4-chlorophenyl){1-[4-(methylsulfanyl)phenyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl}methanone
(4-chlorophenyl){1-[4-(methylsulfanyl)phenyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl}methanone
Compound characteristics
| Compound ID: | G811-0515 |
| Compound Name: | (4-chlorophenyl){1-[4-(methylsulfanyl)phenyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl}methanone |
| Molecular Weight: | 432.97 |
| Molecular Formula: | C25 H21 Cl N2 O S |
| Smiles: | CSc1ccc(cc1)C1c2c(CCN1C(c1ccc(cc1)[Cl])=O)c1ccccc1[nH]2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3906 |
| logD: | 6.3906 |
| logSw: | -6.4607 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.0715 |
| InChI Key: | BNCKEJDQRRUGPS-XMMPIXPASA-N |